New Synthetic Drugs Database

2-(Benzylamino)-1-(4-methylphenyl)butan-1-one

Formula:
C18H21NO
Average mass:
267.365447998 Da
Monoisotopic mass:
267.162322998 Da
InChI:
InChI=1S/C18H21NO/c1-3-17(19-13-15-7-5-4-6-8-15)18(20)16-11-9-14(2)10-12-16/h4-12,17,19H,3,13H2,1-2H3
InChI key:
ZWTIKPPAPCJQNP-UHFFFAOYSA-N
SMILES:
Cc1ccc(cc1)C(=O)C(CC)NCc1ccccc1

Information

IUPAC name:
2-(Benzylamino)-1-(4-methylphenyl)butan-1-one
Alternative names:
4-methylbuphedrone, N-benzyl derivative

Edit