New Synthetic Drugs Database

(1-Butyl-1H-indol-3-yl)(4-methylnaphthalen-1-yl)methanone

Formula:
C24H23NO
Average mass:
341.445526123 Da
Monoisotopic mass:
341.177978516 Da
InChI:
InChI=1S/C24H23NO/c1-3-4-15-25-16-22(20-11-7-8-12-23(20)25)24(26)21-14-13-17(2)18-9-5-6-10-19(18)21/h5-14,16H,3-4,15H2,1-2H3
InChI key:
DOKBVCMQPGKQGV-UHFFFAOYSA-N
SMILES:
Cc1ccc(C(=O)c2c[n](CCCC)c3ccccc32)c2ccccc12

Information

IUPAC name:
(1-Butyl-1H-indol-3-yl)(4-methylnaphthalen-1-yl)methanone
Alternative names:
JWH-073 methyl derivative

Edit