New Synthetic Drugs Database

N-{2-[4-(Dimethylamino)phenyl]ethyl}-3-ethyl-5-fluoro-1H-indole-2-carboxamide

Formula:
C21H24FN3O
Average mass:
353.433166504 Da
Monoisotopic mass:
353.190338135 Da
InChI:
InChI=1S/C21H24FN3O/c1-4-17-18-13-15(22)7-10-19(18)24-20(17)21(26)23-12-11-14-5-8-16(9-6-14)25(2)3/h5-10,13,24H,4,11-12H2,1-3H3,(H,23,26)
InChI key:
MUYUEZAKMLKZSO-UHFFFAOYSA-N
SMILES:
CCc1c([nH]c2ccc(F)cc21)C(=O)NCCc1ccc(cc1)N(C)C

Information

IUPAC name:
N-{2-[4-(Dimethylamino)phenyl]ethyl}-3-ethyl-5-fluoro-1H-indole-2-carboxamide
Alternative names:
Org 27759

Edit