New Synthetic Drugs Database

(4-Methylnaphthalen-1-yl)[1-(pent-4-en-1-yl)-1H-indol-3-yl]methanone

Formula:
C25H23NO
Average mass:
353.456237793 Da
Monoisotopic mass:
353.177978516 Da
InChI:
InChI=1S/C25H23NO/c1-3-4-9-16-26-17-23(21-12-7-8-13-24(21)26)25(27)22-15-14-18(2)19-10-5-6-11-20(19)22/h3,5-8,10-15,17H,1,4,9,16H2,2H3
InChI key:
FJRCMNJZLRNCND-UHFFFAOYSA-N
SMILES:
Cc1ccc(C(=O)c2c[n](CCCC=C)c3ccccc32)c2ccccc21

Information

IUPAC name:
(4-Methylnaphthalen-1-yl)[1-(pent-4-en-1-yl)-1H-indol-3-yl]methanone
Alternative names:
JWH-122 pentenyl derivative

Edit