New Synthetic Drugs Database

2,3-Dihydro-1H-inden-2-amine

Formula:
C9H11N
Average mass:
133.190338135 Da
Monoisotopic mass:
133.089141846 Da
InChI:
InChI=1S/C9H11N/c10-9-5-7-3-1-2-4-8(7)6-9/h1-4,9H,5-6,10H2
InChI key:
LMHHFZAXSANGGM-UHFFFAOYSA-N
SMILES:
NC1Cc2ccccc2C1

Information

IUPAC name:
2,3-Dihydro-1H-inden-2-amine
Alternative names:
2-Aminoindan
CAS RNs:
2975-41-9

Edit