New Synthetic Drugs Database

4-Methyl-5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-amine

Formula:
C11H14N2O
Average mass:
190.241668701 Da
Monoisotopic mass:
190.110610962 Da
InChI:
InChI=1S/C11H14N2O/c1-7-3-5-9(6-4-7)10-8(2)13-11(12)14-10/h3-6,8,10H,1-2H3,(H2,12,13)
InChI key:
NPILLHMQNMXXTL-UHFFFAOYSA-N
SMILES:
Cc1ccc(cc1)C1OC(N)=NC1C

Information

IUPAC name:
4-Methyl-5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-amine
Alternative names:
Serotoni, 4,4'-DMAR, 4-M-4-MAR, 4-methyl-U4Euh, 4-methylaminorex p-methyl derivative

Edit