New Synthetic Drugs Database

{2-[3-(Aminomethyl)-5-methyl-4H-1,2,4-triazol-4-yl]-5-chlorophenyl}(phenyl)methanone

Formula:
C17H15ClN4O
Average mass:
326.780212402 Da
Monoisotopic mass:
326.093444824 Da
InChI:
InChI=1S/C17H15ClN4O/c1-11-20-21-16(10-19)22(11)15-8-7-13(18)9-14(15)17(23)12-5-3-2-4-6-12/h2-9H,10,19H2,1H3
InChI key:
WWADXOXMCNJJKR-UHFFFAOYSA-N
SMILES:
Cc1[n][n]c(CN)[n]1-c1ccc(Cl)cc1C(=O)c1ccccc1

Information

IUPAC name:
{2-[3-(Aminomethyl)-5-methyl-4H-1,2,4-triazol-4-yl]-5-chlorophenyl}(phenyl)methanone
Alternative names:
Alprazolam triazolobenzophenone derivative

Edit