New Synthetic Drugs Database

3,4-Dichloro-N-[2-(dimethylamino)cyclohexyl]-N-methylbenzamide

Formula:
C16H22Cl2N2O
Average mass:
329.264678955 Da
Monoisotopic mass:
328.110931396 Da
InChI:
InChI=1S/C16H22Cl2N2O/c1-19(2)14-6-4-5-7-15(14)20(3)16(21)11-8-9-12(17)13(18)10-11/h8-10,14-15H,4-7H2,1-3H3
InChI key:
JGPNMZWFVRQNGU-UHFFFAOYSA-N
SMILES:
CN(C)C1CCCCC1N(C)C(=O)c1ccc(Cl)c(Cl)c1

Information

IUPAC name:
3,4-Dichloro-N-[2-(dimethylamino)cyclohexyl]-N-methylbenzamide
Alternative names:
U-47700

Edit