New Synthetic Drugs Database

1-(2,3-Dihydro-1H-inden-5-yl)-2-(pyrrolidin-1-yl)butan-1-one

Formula:
C17H23NO
Average mass:
257.370635986 Da
Monoisotopic mass:
257.177978516 Da
InChI:
InChI=1S/C17H23NO/c1-2-16(18-10-3-4-11-18)17(19)15-9-8-13-6-5-7-14(13)12-15/h8-9,12,16H,2-7,10-11H2,1H3
InChI key:
HLBROWUOAAQHCM-UHFFFAOYSA-N
SMILES:
CCC(C(=O)c1cc2CCCc2cc1)N1CCCC1

Information

IUPAC name:
1-(2,3-Dihydro-1H-inden-5-yl)-2-(pyrrolidin-1-yl)butan-1-one
Alternative names:
5-PPDi

Edit