New Synthetic Drugs Database

3,5-Dimethyl-2-phenylmorpholine

Formula:
C12H17NO
Average mass:
191.269485474 Da
Monoisotopic mass:
191.131011963 Da
InChI:
InChI=1S/C12H17NO/c1-9-8-14-12(10(2)13-9)11-6-4-3-5-7-11/h3-7,9-10,12-13H,8H2,1-2H3
InChI key:
YKCSYIYQRSVLAK-UHFFFAOYSA-N
SMILES:
CC1NC(C)COC1c1ccccc1

Information

IUPAC name:
3,5-Dimethyl-2-phenylmorpholine
Alternative names:
PDM-35

Edit